Draw a condensed structural formula for each of the following alkanes: a. 3 -ethylpentane b. 3 -ethyl-2-methylpentane c. 4 -ethyl- 2,2 -dimethyloctane d. 2 -bromopropane e. 2,3 -dichloro-2-methylbutane The Correct…
What is the condensed formula notation for 1,4-dibromo-2-methylpentane? Select the correct answer below: Br-CH-CH-C(Br)(CH)-CHCH-CH-CH(Br)-CH(Br)-CH(CH)-CHBr-CH-CH(CH)-CH-CH(Br)-CHCH-CH(Br)-CH-CH(CH)-CH-CH-Br The Correct Answer and Explanation is: The correct condensed formula notation for 1,4-dibromo-2-methylpentane is: BrCH₂CH(CH₃)CH₂CHBrCH₃ Explanation…
What is chromatin? a. The DNA-protein complex that makes up eukaryotic chromosomes. b. A special mini-chromosome found in yeast. c. The location in the nucleus where ribosome biosynthesis takes place.…
A 1400 kg car accelerates uniformly from rest to 60 mph in 6 s. Find the net force needed to produce this motion. The correct answer and explanation is: To…
If a drop of blood is 0.05 mL, how many drops of blood are in a blood collection tube that holds 2 mL? The correct answer and explanation is: To…
I am always running, but never get tired or hot. What am I? The correct answer and explanation is: The correct answer is: A river. Explanation (300 words): This classic…
What is the Lewis dot structure of BF3 The correct answer and explanation is: Correct Answer: Lewis Dot Structure of BF₃ The Lewis dot structure of boron trifluoride (BF₃) is:…
Answer the following questions. Arrange the following compounds in the increasing order of their boiling points: CH4, CH3CHO, CH3CH2OH, CH3COOH. Write simple chemical tests to distinguish between the following pair…
Draw the Lewis structure of PH3 molecule and state its electron domain geometry. The geometry of PH3 is pyramidal The Correct Answer and Explanation is: Lewis Structure of PH₃ (Phosphine)…
Melting Points of Derivatives of Some Aldehydes and Ketones Melting Points (°C) Compound Formula MW Acetone CH3COCH3 58.08 0.79 Butanal CH3CH2CH2CHO 72.10 0.82 Dichloroacetone CH3COCHCl2 86.13 0.81 Furfural C5H4OCHO 96.08…
admin